What is the empirical formula for C17H21NO4?
Identification of Cocaine Chemical Compound
| Chemical Formula | C17H21NO4 |
|---|---|
| SMILES String | COC(=O)C1C(CC2CCC1N2C)OC(=O)c3ccccc3 |
| InChI | InChI=1S/C17H21NO4/c1-18-12-8-9-13(18)15(17(20)21-2)14(10-12)22-16(19)11-6-4-3-5-7-11/h3-7,12-15H,8-10H2,1-2H3/t12-,13+,14-,15+/m0/s1 |
| InChIKey | ZPUCINDJVBIVPJ-LJISPDSOSA-N |
What does C17H21NO4 stand for?
The molecular formula C17H21NO4 may refer to: Cocaine. Cocaine reverse ester. Fenoterol. Hydromorphinol.
What is the molar mass of sucrose?
342.2965 g/mol
Table sugar/Molar mass
What is the molar mass of sucrose c12 h22 o11?
Hence the Molar mass of the Sucrose is equals to 342 g/mole.
What is the molecular formula for cholesterol?
C27H46O
Cholesterol/Formula
What type of drug is benzoylecgonine?
Benzoylecgonine is the major metabolite of cocaine. It is formed by hydrolysis of cocaine in the liver, catalysed by carboxylesterases. It is excreted in the urine of cocaine users after processing in the liver.
What is the formula of sucrose?
C12H22O11
Table sugar/Formula
What is unit of molar mass?
Kilogram per mole
Molar mass/SI units
What is structure of sucrose?
Sucrose is made up of one molecule of glucose and one molecule of fructose joined together. It is a disaccharide, a molecule composed of two monosaccharides: glucose and fructose. Sucrose is produced naturally in plants, from which table sugar is refined. It has the molecular formula C12H22O11.
Is Coca Cola acidic or basic?
How acidic is Coke? Its pH is reported to be 2.6 to 2.7, mainly due to H3PO4, phosphoric acid. As a fizzy drink, it contains plenty of dissolved carbon dioxide, but this makes very little contribution to the acidity.
Is Pepsi acidic or basic?
Pepsi pH Level While the taste may be different, the pH levels are extremely close. Pepsi has a pH level of 2.53, which means that it is only a tiny bit less acidic than Coca-Cola.